About 2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole
2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole (PubChem CID 162649735) has the molecular formula C32H35NO
and a molecular weight of 449.64 g/mol. Its IUPAC name is 2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole.
Molecular Properties
| Compound Name | 2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole |
| PubChem CID | 162649735 |
| Molecular Formula | C32H35NO |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole |
| SMILES | Cc1c(C(c2ccccc2)c2cc3cc(C(C)(C)C)cc(C(C)(C)C)c3o2)[nH]c2ccccc12 |
| InChI | InChI=1S/C32H35NO/c1-20-24-15-11-12-16-26(24)33-29(20)28(21-13-9-8-10-14-21)27-18-22-17-23(31(2,3)4)19-25(30(22)34-27)32(5,6)7/h8-19,28,33H,1-7H3 |
| InChIKey | RCXQYNITDFUABZ-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole?
The IUPAC name of 2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole (CID 162649735) is 2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole.
What is the SMILES notation for 2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole?
The canonical SMILES for 2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole is Cc1c(C(c2ccccc2)c2cc3cc(C(C)(C)C)cc(C(C)(C)C)c3o2)[nH]c2ccccc12.
What is the InChIKey of 2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole?
The InChIKey is RCXQYNITDFUABZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H35NO/c1-20-24-15-11-12-16-26(24)33-29(20)28(21-13-9-8-10-14-21)27-18-22-17-23(31(2,3)4)19-25(30(22)34-27)32(5,6)7/h8-19,28,33H,1-7H3.
What are the key properties of 2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole?
2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole has a molecular weight of 449.64 g/mol, XLogP of 9.00, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,7-ditert-butyl-1-benzofuran-2-yl)-phenylmethyl]-3-methyl-1H-indole is sourced from PubChem (CID 162649735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).