C38H42N14O8 — CID 162649777
dibenzyl 4,10-bis[2-(2-amino-6-oxo-1H-purin-9-yl)acetyl]-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylate (PubChem CID 162649777) has the molecular formula C38H42N14O8 and a molecular weight of 822.84 g/mol. Its IUPAC name is dibenzyl 4,10-bis[2-(2-amino-6-oxo-1H-purin-9-yl)acetyl]-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylate.
| Compound Name | dibenzyl 4,10-bis[2-(2-amino-6-oxo-1H-purin-9-yl)acetyl]-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylate |
|---|---|
| PubChem CID | 162649777 |
| Molecular Formula | C38H42N14O8 |
| Molecular Weight | 822.84 g/mol |
| Exact Mass | 822.33 |
| IUPAC Name | dibenzyl 4,10-bis[2-(2-amino-6-oxo-1H-purin-9-yl)acetyl]-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylate |
| SMILES | Nc1nc2c(ncn2CC(=O)N2CCN(C(=O)OCc3ccccc3)CCN(C(=O)Cn3cnc4c(=O)[nH]c(N)nc43)CCN(C(=O)OCc3ccccc3)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C38H42N14O8/c39-35-43-31-29(33(55)45-35)41-23-51(31)19-27(53)47-11-15-49(37(57)59-21-25-7-3-1-4-8-25)16-12-48(28(54)20-52-24-42-30-32(52)44-36(40)46-34(30)56)14-18-50(17-13-47)38(58)60-22-26-9-5-2-6-10-26/h1-10,23-24H,11-22H2,(H3,39,43,45,55)(H3,40,44,46,56) |
| InChIKey | CYOWYNRHKMITFG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 278.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.84 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |