C16H24O3 — CID 162649933
2-methoxy-4-[2-[(1S,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]-2H-furan-5-one (PubChem CID 162649933) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-methoxy-4-[2-[(1S,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]-2H-furan-5-one.
| Compound Name | 2-methoxy-4-[2-[(1S,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 162649933 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-methoxy-4-[2-[(1S,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]-2H-furan-5-one |
| SMILES | COC1C=C(CC[C@]2(C)C(C)=CCC[C@H]2C)C(=O)O1 |
| InChI | InChI=1S/C16H24O3/c1-11-6-5-7-12(2)16(11,3)9-8-13-10-14(18-4)19-15(13)17/h6,10,12,14H,5,7-9H2,1-4H3/t12-,14?,16-/m1/s1 |
| InChIKey | WKZFITLESSKPNQ-QXDOLYAVSA-N |
| XLogP | 3.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|