C17H17FN4O5S — CID 162649944
N-[(3S)-3-amino-4-(4-cyano-3-fluorophenoxy)butyl]-2-nitrobenzenesulfonamide (PubChem CID 162649944) has the molecular formula C17H17FN4O5S and a molecular weight of 408.41 g/mol. Its IUPAC name is N-[(3S)-3-amino-4-(4-cyano-3-fluorophenoxy)butyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(3S)-3-amino-4-(4-cyano-3-fluorophenoxy)butyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 162649944 |
| Molecular Formula | C17H17FN4O5S |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N-[(3S)-3-amino-4-(4-cyano-3-fluorophenoxy)butyl]-2-nitrobenzenesulfonamide |
| SMILES | N#Cc1ccc(OC[C@@H](N)CCNS(=O)(=O)c2ccccc2[N+](=O)[O-])cc1F |
| InChI | InChI=1S/C17H17FN4O5S/c18-15-9-14(6-5-12(15)10-19)27-11-13(20)7-8-21-28(25,26)17-4-2-1-3-16(17)22(23)24/h1-6,9,13,21H,7-8,11,20H2/t13-/m0/s1 |
| InChIKey | KRAUBJYBOJISJP-ZDUSSCGKSA-N |
| XLogP | 1.68 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|