C32H27IO6 — CID 162650022
(6S,6aR,7S,12aR)-11-iodo-1,8-dimethoxy-6-phenyl-7-[(E)-2-phenylethenyl]-6,6a,7,12a-tetrahydrochromeno[3,2-c]chromene-3,10-diol (PubChem CID 162650022) has the molecular formula C32H27IO6 and a molecular weight of 634.47 g/mol. Its IUPAC name is (6S,6aR,7S,12aR)-11-iodo-1,8-dimethoxy-6-phenyl-7-[(E)-2-phenylethenyl]-6,6a,7,12a-tetrahydrochromeno[3,2-c]chromene-3,10-diol.
| Compound Name | (6S,6aR,7S,12aR)-11-iodo-1,8-dimethoxy-6-phenyl-7-[(E)-2-phenylethenyl]-6,6a,7,12a-tetrahydrochromeno[3,2-c]chromene-3,10-diol |
|---|---|
| PubChem CID | 162650022 |
| Molecular Formula | C32H27IO6 |
| Molecular Weight | 634.47 g/mol |
| Exact Mass | 634.09 |
| IUPAC Name | (6S,6aR,7S,12aR)-11-iodo-1,8-dimethoxy-6-phenyl-7-[(E)-2-phenylethenyl]-6,6a,7,12a-tetrahydrochromeno[3,2-c]chromene-3,10-diol |
| SMILES | COc1cc(O)c(I)c2c1[C@@H](/C=C/c1ccccc1)[C@@H]1[C@@H](c3ccccc3)Oc3cc(O)cc(OC)c3[C@@H]1O2 |
| InChI | InChI=1S/C32H27IO6/c1-36-23-15-20(34)16-25-28(23)31-27(30(38-25)19-11-7-4-8-12-19)21(14-13-18-9-5-3-6-10-18)26-24(37-2)17-22(35)29(33)32(26)39-31/h3-17,21,27,30-31,34-35H,1-2H3/b14-13+/t21-,27-,30-,31-/m1/s1 |
| InChIKey | OOEDMHZBNCISDK-MNRWYXMNSA-N |
| XLogP | 7.40 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.47 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|