C28H50N2O2 — CID 162650105
(9Z,12Z,15Z)-N-[2-(2-propylpentanoylamino)ethyl]octadeca-9,12,15-trienamide (PubChem CID 162650105) has the molecular formula C28H50N2O2 and a molecular weight of 446.72 g/mol. Its IUPAC name is (9Z,12Z,15Z)-N-[2-(2-propylpentanoylamino)ethyl]octadeca-9,12,15-trienamide.
| Compound Name | (9Z,12Z,15Z)-N-[2-(2-propylpentanoylamino)ethyl]octadeca-9,12,15-trienamide |
|---|---|
| PubChem CID | 162650105 |
| Molecular Formula | C28H50N2O2 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.39 |
| IUPAC Name | (9Z,12Z,15Z)-N-[2-(2-propylpentanoylamino)ethyl]octadeca-9,12,15-trienamide |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)NCCNC(=O)C(CCC)CCC |
| InChI | InChI=1S/C28H50N2O2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-27(31)29-24-25-30-28(32)26(21-5-2)22-6-3/h7-8,10-11,13-14,26H,4-6,9,12,15-25H2,1-3H3,(H,29,31)(H,30,32)/b8-7-,11-10-,14-13- |
| InChIKey | AQBBPZJAPCGKPR-JPFHKJGASA-N |
| XLogP | 7.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|