C22H38O3 — CID 162650113
(E)-5-[(1S,4aR,5S,8aR)-5-(dimethoxymethyl)-2,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-en-1-ol (PubChem CID 162650113) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is (E)-5-[(1S,4aR,5S,8aR)-5-(dimethoxymethyl)-2,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-en-1-ol.
| Compound Name | (E)-5-[(1S,4aR,5S,8aR)-5-(dimethoxymethyl)-2,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-en-1-ol |
|---|---|
| PubChem CID | 162650113 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | (E)-5-[(1S,4aR,5S,8aR)-5-(dimethoxymethyl)-2,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-en-1-ol |
| SMILES | COC(OC)[C@@]1(C)CCC[C@@]2(C)[C@H]1CC=C(C)[C@@H]2CC/C(C)=C/CO |
| InChI | InChI=1S/C22H38O3/c1-16(12-15-23)8-10-18-17(2)9-11-19-21(18,3)13-7-14-22(19,4)20(24-5)25-6/h9,12,18-20,23H,7-8,10-11,13-15H2,1-6H3/b16-12+/t18-,19+,21+,22-/m0/s1 |
| InChIKey | XNTZCKXWOGVASS-KKIXBDIFSA-N |
| XLogP | 5.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|