C20H27NO2 — CID 162650175
(1R,4S,9S,10R,13S,14E)-14-methoxyimino-9,13-dimethyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-7-en-6-one (PubChem CID 162650175) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (1R,4S,9S,10R,13S,14E)-14-methoxyimino-9,13-dimethyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-7-en-6-one.
| Compound Name | (1R,4S,9S,10R,13S,14E)-14-methoxyimino-9,13-dimethyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-7-en-6-one |
|---|---|
| PubChem CID | 162650175 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (1R,4S,9S,10R,13S,14E)-14-methoxyimino-9,13-dimethyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-7-en-6-one |
| SMILES | C=C1C(=O)C=C[C@]2(C)[C@@H]1CC[C@@]13C/C(=N\OC)[C@@](C)(CC[C@H]12)C3 |
| InChI | InChI=1S/C20H27NO2/c1-13-14-5-10-20-11-17(21-23-4)18(2,12-20)8-7-16(20)19(14,3)9-6-15(13)22/h6,9,14,16H,1,5,7-8,10-12H2,2-4H3/b21-17+/t14-,16+,18+,19-,20+/m1/s1 |
| InChIKey | OOZFQCGNZIJNCD-HXDSIGIOSA-N |
| XLogP | 4.30 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|