C22H23ClN2O5 — CID 162650561
ethyl 11-chloro-13-[(2,5-dimethoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-12-carboxylate (PubChem CID 162650561) has the molecular formula C22H23ClN2O5 and a molecular weight of 430.89 g/mol. Its IUPAC name is ethyl 11-chloro-13-[(2,5-dimethoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-12-carboxylate.
| Compound Name | ethyl 11-chloro-13-[(2,5-dimethoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 162650561 |
| Molecular Formula | C22H23ClN2O5 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | ethyl 11-chloro-13-[(2,5-dimethoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-12-carboxylate |
| SMILES | CCOC(=O)c1c(Cl)c2c(n1Cc1cc(OC)ccc1OC)-c1oncc1CCC2 |
| InChI | InChI=1S/C22H23ClN2O5/c1-4-29-22(26)20-18(23)16-7-5-6-13-11-24-30-21(13)19(16)25(20)12-14-10-15(27-2)8-9-17(14)28-3/h8-11H,4-7,12H2,1-3H3 |
| InChIKey | XHGPNFMFDGRMNT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |