C22H21F3N6 — CID 162650581
7-[(1R)-1-phenyl-3-[[2-(trifluoromethyl)phenyl]methylamino]propyl]-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 162650581) has the molecular formula C22H21F3N6 and a molecular weight of 426.45 g/mol. Its IUPAC name is 7-[(1R)-1-phenyl-3-[[2-(trifluoromethyl)phenyl]methylamino]propyl]-2H-triazolo[4,5-b]pyridin-5-amine.
| Compound Name | 7-[(1R)-1-phenyl-3-[[2-(trifluoromethyl)phenyl]methylamino]propyl]-2H-triazolo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 162650581 |
| Molecular Formula | C22H21F3N6 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 7-[(1R)-1-phenyl-3-[[2-(trifluoromethyl)phenyl]methylamino]propyl]-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | Nc1cc([C@H](CCNCc2ccccc2C(F)(F)F)c2ccccc2)c2n[nH]nc2n1 |
| InChI | InChI=1S/C22H21F3N6/c23-22(24,25)18-9-5-4-8-15(18)13-27-11-10-16(14-6-2-1-3-7-14)17-12-19(26)28-21-20(17)29-31-30-21/h1-9,12,16,27H,10-11,13H2,(H3,26,28,29,30,31)/t16-/m1/s1 |
| InChIKey | MUZCZZKXXSGTOG-MRXNPFEDSA-N |
| XLogP | 4.27 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|