C23H14F9N5O3 — CID 162650599
4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(trifluoromethyl)pyrazol-1-yl]phenyl]benzamide (PubChem CID 162650599) has the molecular formula C23H14F9N5O3 and a molecular weight of 579.38 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(trifluoromethyl)pyrazol-1-yl]phenyl]benzamide.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(trifluoromethyl)pyrazol-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 162650599 |
| Molecular Formula | C23H14F9N5O3 |
| Molecular Weight | 579.38 g/mol |
| Exact Mass | 579.10 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-[4-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(trifluoromethyl)pyrazol-1-yl]phenyl]benzamide |
| SMILES | Cc1noc(-c2cnn(-c3ccc(NC(=O)c4ccc(C(O)(C(F)(F)F)C(F)(F)F)cc4)cc3)c2C(F)(F)F)n1 |
| InChI | InChI=1S/C23H14F9N5O3/c1-11-34-19(40-36-11)16-10-33-37(17(16)21(24,25)26)15-8-6-14(7-9-15)35-18(38)12-2-4-13(5-3-12)20(39,22(27,28)29)23(30,31)32/h2-10,39H,1H3,(H,35,38) |
| InChIKey | FWDTYFAMJSBEBV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.38 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |