C31H28F3N5O3S — CID 162650606
N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-5-[[2-(2,2,2-trifluoroethoxy)benzoyl]amino]pentyl]-1,3-thiazole-5-carboxamide (PubChem CID 162650606) has the molecular formula C31H28F3N5O3S and a molecular weight of 607.66 g/mol. Its IUPAC name is N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-5-[[2-(2,2,2-trifluoroethoxy)benzoyl]amino]pentyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-5-[[2-(2,2,2-trifluoroethoxy)benzoyl]amino]pentyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 162650606 |
| Molecular Formula | C31H28F3N5O3S |
| Molecular Weight | 607.66 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | N-[(1S)-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)-5-[[2-(2,2,2-trifluoroethoxy)benzoyl]amino]pentyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(N[C@@H](CCCCNC(=O)c1ccccc1OCC(F)(F)F)c1ncc(-c2ccc3ccccc3c2)[nH]1)c1cncs1 |
| InChI | InChI=1S/C31H28F3N5O3S/c32-31(33,34)18-42-26-11-4-3-9-23(26)29(40)36-14-6-5-10-24(39-30(41)27-17-35-19-43-27)28-37-16-25(38-28)22-13-12-20-7-1-2-8-21(20)15-22/h1-4,7-9,11-13,15-17,19,24H,5-6,10,14,18H2,(H,36,40)(H,37,38)(H,39,41)/t24-/m0/s1 |
| InChIKey | CCXFNJSHGTUHNE-DEOSSOPVSA-N |
| XLogP | 6.70 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.66 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|