C30H35N9O6 — CID 162650651
5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate (PubChem CID 162650651) has the molecular formula C30H35N9O6 and a molecular weight of 617.67 g/mol. Its IUPAC name is 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate.
| Compound Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate |
|---|---|
| PubChem CID | 162650651 |
| Molecular Formula | C30H35N9O6 |
| Molecular Weight | 617.67 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate |
| SMILES | Cn1cc2c(nc(NC(=O)Nc3ccc(CC(=O)OCCCCCNC(=O)OC(C)(C)C)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C30H35N9O6/c1-30(2,3)45-29(42)31-14-6-5-7-15-44-23(40)17-19-10-12-20(13-11-19)32-28(41)35-27-34-24-21(18-38(4)36-24)26-33-25(37-39(26)27)22-9-8-16-43-22/h8-13,16,18H,5-7,14-15,17H2,1-4H3,(H,31,42)(H2,32,34,35,36,41) |
| InChIKey | XMDPZUSARWMGBX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.67 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|