C18H21N5O3 — CID 162650709
17-(methylamino)-8,14-dioxa-1,16,19,22-tetrazatetracyclo[13.5.2.13,7.018,21]tricosa-3(23),4,6,15,17,21-hexaen-20-one (PubChem CID 162650709) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is 17-(methylamino)-8,14-dioxa-1,16,19,22-tetrazatetracyclo[13.5.2.13,7.018,21]tricosa-3(23),4,6,15,17,21-hexaen-20-one.
| Compound Name | 17-(methylamino)-8,14-dioxa-1,16,19,22-tetrazatetracyclo[13.5.2.13,7.018,21]tricosa-3(23),4,6,15,17,21-hexaen-20-one |
|---|---|
| PubChem CID | 162650709 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 17-(methylamino)-8,14-dioxa-1,16,19,22-tetrazatetracyclo[13.5.2.13,7.018,21]tricosa-3(23),4,6,15,17,21-hexaen-20-one |
| SMILES | CNc1nc2nc3c1[nH]c(=O)n3Cc1cccc(c1)OCCCCCO2 |
| InChI | InChI=1S/C18H21N5O3/c1-19-15-14-16-22-17(21-15)26-9-4-2-3-8-25-13-7-5-6-12(10-13)11-23(16)18(24)20-14/h5-7,10H,2-4,8-9,11H2,1H3,(H,20,24)(H,19,21,22) |
| InChIKey | VRGRKKSAGJKMRY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |