C22H23F2N3O — CID 162650712
1'-[(2,4-difluorophenyl)methyl]-6-methoxyspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-pyrrolidine] (PubChem CID 162650712) has the molecular formula C22H23F2N3O and a molecular weight of 383.44 g/mol. Its IUPAC name is 1'-[(2,4-difluorophenyl)methyl]-6-methoxyspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-pyrrolidine].
| Compound Name | 1'-[(2,4-difluorophenyl)methyl]-6-methoxyspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-pyrrolidine] |
|---|---|
| PubChem CID | 162650712 |
| Molecular Formula | C22H23F2N3O |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1'-[(2,4-difluorophenyl)methyl]-6-methoxyspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-pyrrolidine] |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCNC31CCN(Cc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C22H23F2N3O/c1-28-16-4-5-20-18(11-16)17-6-8-25-22(21(17)26-20)7-9-27(13-22)12-14-2-3-15(23)10-19(14)24/h2-5,10-11,25-26H,6-9,12-13H2,1H3 |
| InChIKey | GVWCIXNSHWTWLZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |