About 2-phenylpyrido[3,4-g]quinazolin-10-amine
2-phenylpyrido[3,4-g]quinazolin-10-amine (PubChem CID 162650720) has the molecular formula C17H12N4
and a molecular weight of 272.31 g/mol. Its IUPAC name is 2-phenylpyrido[3,4-g]quinazolin-10-amine.
Molecular Properties
| Compound Name | 2-phenylpyrido[3,4-g]quinazolin-10-amine |
| PubChem CID | 162650720 |
| Molecular Formula | C17H12N4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-phenylpyrido[3,4-g]quinazolin-10-amine |
| SMILES | Nc1c2ccncc2cc2cnc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C17H12N4/c18-15-14-6-7-19-9-12(14)8-13-10-20-17(21-16(13)15)11-4-2-1-3-5-11/h1-10H,18H2 |
| InChIKey | UJKOKFUHOFKRNN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylpyrido[3,4-g]quinazolin-10-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpyrido[3,4-g]quinazolin-10-amine?
The IUPAC name of 2-phenylpyrido[3,4-g]quinazolin-10-amine (CID 162650720) is 2-phenylpyrido[3,4-g]quinazolin-10-amine.
What is the SMILES notation for 2-phenylpyrido[3,4-g]quinazolin-10-amine?
The canonical SMILES for 2-phenylpyrido[3,4-g]quinazolin-10-amine is Nc1c2ccncc2cc2cnc(-c3ccccc3)nc12.
What is the InChIKey of 2-phenylpyrido[3,4-g]quinazolin-10-amine?
The InChIKey is UJKOKFUHOFKRNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N4/c18-15-14-6-7-19-9-12(14)8-13-10-20-17(21-16(13)15)11-4-2-1-3-5-11/h1-10H,18H2.
What are the key properties of 2-phenylpyrido[3,4-g]quinazolin-10-amine?
2-phenylpyrido[3,4-g]quinazolin-10-amine has a molecular weight of 272.31 g/mol, XLogP of 3.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpyrido[3,4-g]quinazolin-10-amine is sourced from PubChem (CID 162650720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).