C23H35NO6 — CID 162650838
(2E,4S,5R,7E)-8-[(1S,3aR,4S,7S,7aS)-3a-hydroxy-6,7-dimethyl-1-(2-methylpropyl)-3-oxo-2,4,7,7a-tetrahydro-1H-isoindol-4-yl]-4,5-dihydroxy-7-methylocta-2,7-dienoic acid (PubChem CID 162650838) has the molecular formula C23H35NO6 and a molecular weight of 421.53 g/mol. Its IUPAC name is (2E,4S,5R,7E)-8-[(1S,3aR,4S,7S,7aS)-3a-hydroxy-6,7-dimethyl-1-(2-methylpropyl)-3-oxo-2,4,7,7a-tetrahydro-1H-isoindol-4-yl]-4,5-dihydroxy-7-methylocta-2,7-dienoic acid.
| Compound Name | (2E,4S,5R,7E)-8-[(1S,3aR,4S,7S,7aS)-3a-hydroxy-6,7-dimethyl-1-(2-methylpropyl)-3-oxo-2,4,7,7a-tetrahydro-1H-isoindol-4-yl]-4,5-dihydroxy-7-methylocta-2,7-dienoic acid |
|---|---|
| PubChem CID | 162650838 |
| Molecular Formula | C23H35NO6 |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | (2E,4S,5R,7E)-8-[(1S,3aR,4S,7S,7aS)-3a-hydroxy-6,7-dimethyl-1-(2-methylpropyl)-3-oxo-2,4,7,7a-tetrahydro-1H-isoindol-4-yl]-4,5-dihydroxy-7-methylocta-2,7-dienoic acid |
| SMILES | CC1=C[C@H](/C=C(\C)C[C@@H](O)[C@@H](O)/C=C/C(=O)O)[C@]2(O)C(=O)N[C@@H](CC(C)C)[C@@H]2[C@@H]1C |
| InChI | InChI=1S/C23H35NO6/c1-12(2)8-17-21-15(5)14(4)11-16(23(21,30)22(29)24-17)9-13(3)10-19(26)18(25)6-7-20(27)28/h6-7,9,11-12,15-19,21,25-26,30H,8,10H2,1-5H3,(H,24,29)(H,27,28)/b7-6+,13-9+/t15-,16+,17+,18+,19-,21+,23-/m1/s1 |
| InChIKey | RKLJPIHSUCRBKK-GLNNMULPSA-N |
| XLogP | 1.79 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|