C21H32O4 — CID 162650991
[(5Z,7E,9E,11E)-tetradeca-5,7,9,11-tetraenyl] (2R)-2-acetyloxy-3-methylbutanoate (PubChem CID 162650991) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is [(5Z,7E,9E,11E)-tetradeca-5,7,9,11-tetraenyl] (2R)-2-acetyloxy-3-methylbutanoate.
| Compound Name | [(5Z,7E,9E,11E)-tetradeca-5,7,9,11-tetraenyl] (2R)-2-acetyloxy-3-methylbutanoate |
|---|---|
| PubChem CID | 162650991 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | [(5Z,7E,9E,11E)-tetradeca-5,7,9,11-tetraenyl] (2R)-2-acetyloxy-3-methylbutanoate |
| SMILES | CC/C=C/C=C/C=C/C=C\CCCCOC(=O)[C@H](OC(C)=O)C(C)C |
| InChI | InChI=1S/C21H32O4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-24-21(23)20(18(2)3)25-19(4)22/h6-13,18,20H,5,14-17H2,1-4H3/b7-6+,9-8+,11-10+,13-12-/t20-/m1/s1 |
| InChIKey | ZKTHLPSCZXABNW-NBLJNUFQSA-N |
| XLogP | 4.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|