C17H23NO4 — CID 162651018
(2R,4aR,7R,8aR)-4,7-dimethyl-2-(4-nitrophenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-ol (PubChem CID 162651018) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (2R,4aR,7R,8aR)-4,7-dimethyl-2-(4-nitrophenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-ol.
| Compound Name | (2R,4aR,7R,8aR)-4,7-dimethyl-2-(4-nitrophenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-ol |
|---|---|
| PubChem CID | 162651018 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (2R,4aR,7R,8aR)-4,7-dimethyl-2-(4-nitrophenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-ol |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](c1ccc([N+](=O)[O-])cc1)CC2(C)O |
| InChI | InChI=1S/C17H23NO4/c1-11-3-8-14-15(9-11)22-16(10-17(14,2)19)12-4-6-13(7-5-12)18(20)21/h4-7,11,14-16,19H,3,8-10H2,1-2H3/t11-,14-,15-,16-,17?/m1/s1 |
| InChIKey | OPBWRIJLUQYAHJ-QJRZYCHDSA-N |
| XLogP | 3.61 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|