About 3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole
3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole (PubChem CID 162651050) has the molecular formula C32H34ClNO
and a molecular weight of 484.08 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole.
Molecular Properties
| Compound Name | 3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole |
| PubChem CID | 162651050 |
| Molecular Formula | C32H34ClNO |
| Molecular Weight | 484.08 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole |
| SMILES | Cc1[nH]c2ccccc2c1C(c1ccc(Cl)cc1)c1cc2cc(C(C)(C)C)cc(C(C)(C)C)c2o1 |
| InChI | InChI=1S/C32H34ClNO/c1-19-28(24-10-8-9-11-26(24)34-19)29(20-12-14-23(33)15-13-20)27-17-21-16-22(31(2,3)4)18-25(30(21)35-27)32(5,6)7/h8-18,29,34H,1-7H3 |
| InChIKey | YXHACRVQLWGPSU-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.08 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole?
The IUPAC name of 3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole (CID 162651050) is 3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole.
What is the SMILES notation for 3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole?
The canonical SMILES for 3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole is Cc1[nH]c2ccccc2c1C(c1ccc(Cl)cc1)c1cc2cc(C(C)(C)C)cc(C(C)(C)C)c2o1.
What is the InChIKey of 3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole?
The InChIKey is YXHACRVQLWGPSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H34ClNO/c1-19-28(24-10-8-9-11-26(24)34-19)29(20-12-14-23(33)15-13-20)27-17-21-16-22(31(2,3)4)18-25(30(21)35-27)32(5,6)7/h8-18,29,34H,1-7H3.
What are the key properties of 3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole?
3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole has a molecular weight of 484.08 g/mol, XLogP of 9.65, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-chlorophenyl)-(5,7-ditert-butyl-1-benzofuran-2-yl)methyl]-2-methyl-1H-indole is sourced from PubChem (CID 162651050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).