C10H8F5NO2 — CID 162651169
(Z)-4,4,5,5,5-pentafluoro-1-hydroxy-1-(1-methylpyrrol-3-yl)pent-1-en-3-one (PubChem CID 162651169) has the molecular formula C10H8F5NO2 and a molecular weight of 269.17 g/mol. Its IUPAC name is (Z)-4,4,5,5,5-pentafluoro-1-hydroxy-1-(1-methylpyrrol-3-yl)pent-1-en-3-one.
| Compound Name | (Z)-4,4,5,5,5-pentafluoro-1-hydroxy-1-(1-methylpyrrol-3-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 162651169 |
| Molecular Formula | C10H8F5NO2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (Z)-4,4,5,5,5-pentafluoro-1-hydroxy-1-(1-methylpyrrol-3-yl)pent-1-en-3-one |
| SMILES | Cn1ccc(/C(O)=C/C(=O)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F5NO2/c1-16-3-2-6(5-16)7(17)4-8(18)9(11,12)10(13,14)15/h2-5,17H,1H3/b7-4- |
| InChIKey | VFVQGLWIARGXGW-DAXSKMNVSA-N |
| XLogP | 2.69 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|