About (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid
(2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid (PubChem CID 162651172) has the molecular formula C13H19ClN2O3
and a molecular weight of 286.76 g/mol. Its IUPAC name is (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid |
| PubChem CID | 162651172 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)CC[C@H](NC(=O)c1cc(Cl)c[nH]1)C(=O)O |
| InChI | InChI=1S/C13H19ClN2O3/c1-13(2,3)5-4-9(12(18)19)16-11(17)10-6-8(14)7-15-10/h6-7,9,15H,4-5H2,1-3H3,(H,16,17)(H,18,19)/t9-/m0/s1 |
| InChIKey | YQXNFQSYQSGCSK-VIFPVBQESA-N |
| XLogP | 2.68 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid?
The IUPAC name of (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid (CID 162651172) is (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid.
What is the SMILES notation for (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid?
The canonical SMILES for (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid is CC(C)(C)CC[C@H](NC(=O)c1cc(Cl)c[nH]1)C(=O)O.
What is the InChIKey of (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid?
The InChIKey is YQXNFQSYQSGCSK-VIFPVBQESA-N. The full InChI is InChI=1S/C13H19ClN2O3/c1-13(2,3)5-4-9(12(18)19)16-11(17)10-6-8(14)7-15-10/h6-7,9,15H,4-5H2,1-3H3,(H,16,17)(H,18,19)/t9-/m0/s1.
What are the key properties of (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid?
(2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid has a molecular weight of 286.76 g/mol, XLogP of 2.68, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]-5,5-dimethylhexanoic acid is sourced from PubChem (CID 162651172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).