C23H24N2O4 — CID 162651282
9,10-dimethoxy-2-(3-phenylpropoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 162651282) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 9,10-dimethoxy-2-(3-phenylpropoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 9,10-dimethoxy-2-(3-phenylpropoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 162651282 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 9,10-dimethoxy-2-(3-phenylpropoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | COc1cc2c(cc1OC)-c1cc(OCCCc3ccccc3)nc(=O)n1CC2 |
| InChI | InChI=1S/C23H24N2O4/c1-27-20-13-17-10-11-25-19(18(17)14-21(20)28-2)15-22(24-23(25)26)29-12-6-9-16-7-4-3-5-8-16/h3-5,7-8,13-15H,6,9-12H2,1-2H3 |
| InChIKey | HHGRETKIBFQVPP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|