C28H28N6OS — CID 162651305
(E)-3-[4-[2-[4-(3-aminopiperidin-1-yl)anilino]thieno[2,3-d]pyrimidin-4-yl]oxy-3,5-dimethylphenyl]prop-2-enenitrile (PubChem CID 162651305) has the molecular formula C28H28N6OS and a molecular weight of 496.64 g/mol. Its IUPAC name is (E)-3-[4-[2-[4-(3-aminopiperidin-1-yl)anilino]thieno[2,3-d]pyrimidin-4-yl]oxy-3,5-dimethylphenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[2-[4-(3-aminopiperidin-1-yl)anilino]thieno[2,3-d]pyrimidin-4-yl]oxy-3,5-dimethylphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 162651305 |
| Molecular Formula | C28H28N6OS |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | (E)-3-[4-[2-[4-(3-aminopiperidin-1-yl)anilino]thieno[2,3-d]pyrimidin-4-yl]oxy-3,5-dimethylphenyl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Oc1nc(Nc2ccc(N3CCCC(N)C3)cc2)nc2sccc12 |
| InChI | InChI=1S/C28H28N6OS/c1-18-15-20(5-3-12-29)16-19(2)25(18)35-26-24-11-14-36-27(24)33-28(32-26)31-22-7-9-23(10-8-22)34-13-4-6-21(30)17-34/h3,5,7-11,14-16,21H,4,6,13,17,30H2,1-2H3,(H,31,32,33)/b5-3+ |
| InChIKey | LYHAJVXVRLCNNZ-HWKANZROSA-N |
| XLogP | 6.31 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|