About N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide
N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide (PubChem CID 162651388) has the molecular formula C25H28FN3O3
and a molecular weight of 437.52 g/mol. Its IUPAC name is N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide.
Molecular Properties
| Compound Name | N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide |
| PubChem CID | 162651388 |
| Molecular Formula | C25H28FN3O3 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide |
| SMILES | O=C(c1ccccc1)N(CCCN1CCC(c2noc3cc(F)ccc23)CC1)C1COC1 |
| InChI | InChI=1S/C25H28FN3O3/c26-20-7-8-22-23(15-20)32-27-24(22)18-9-13-28(14-10-18)11-4-12-29(21-16-31-17-21)25(30)19-5-2-1-3-6-19/h1-3,5-8,15,18,21H,4,9-14,16-17H2 |
| InChIKey | OZGHVKYGFAYUBW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide?
The IUPAC name of N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide (CID 162651388) is N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide.
What is the SMILES notation for N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide?
The canonical SMILES for N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide is O=C(c1ccccc1)N(CCCN1CCC(c2noc3cc(F)ccc23)CC1)C1COC1.
What is the InChIKey of N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide?
The InChIKey is OZGHVKYGFAYUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28FN3O3/c26-20-7-8-22-23(15-20)32-27-24(22)18-9-13-28(14-10-18)11-4-12-29(21-16-31-17-21)25(30)19-5-2-1-3-6-19/h1-3,5-8,15,18,21H,4,9-14,16-17H2.
What are the key properties of N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide?
N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide has a molecular weight of 437.52 g/mol, XLogP of 4.08, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]-N-(oxetan-3-yl)benzamide is sourced from PubChem (CID 162651388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).