C17H20N6O3S3 — CID 162651445
[2-oxo-2-(4-sulfamoylanilino)ethyl] 4-pyrimidin-2-ylpiperazine-1-carbodithioate (PubChem CID 162651445) has the molecular formula C17H20N6O3S3 and a molecular weight of 452.59 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-pyrimidin-2-ylpiperazine-1-carbodithioate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-pyrimidin-2-ylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 162651445 |
| Molecular Formula | C17H20N6O3S3 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-pyrimidin-2-ylpiperazine-1-carbodithioate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CSC(=S)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C17H20N6O3S3/c18-29(25,26)14-4-2-13(3-5-14)21-15(24)12-28-17(27)23-10-8-22(9-11-23)16-19-6-1-7-20-16/h1-7H,8-12H2,(H,21,24)(H2,18,25,26) |
| InChIKey | ZVNONGKMYAONBZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|