C19H16O5 — CID 162651655
5-[(4-hydroxy-2,5-dimethylphenyl)methylidene]-2-phenyl-1,3-dioxane-4,6-dione (PubChem CID 162651655) has the molecular formula C19H16O5 and a molecular weight of 324.33 g/mol. Its IUPAC name is 5-[(4-hydroxy-2,5-dimethylphenyl)methylidene]-2-phenyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(4-hydroxy-2,5-dimethylphenyl)methylidene]-2-phenyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 162651655 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 5-[(4-hydroxy-2,5-dimethylphenyl)methylidene]-2-phenyl-1,3-dioxane-4,6-dione |
| SMILES | Cc1cc(C=C2C(=O)OC(c3ccccc3)OC2=O)c(C)cc1O |
| InChI | InChI=1S/C19H16O5/c1-11-9-16(20)12(2)8-14(11)10-15-17(21)23-19(24-18(15)22)13-6-4-3-5-7-13/h3-10,19-20H,1-2H3/b15-10- |
| InChIKey | PYJUAKFEEHTAJC-GDNBJRDFSA-N |
| XLogP | 3.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|