About 1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol
1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol (PubChem CID 162651802) has the molecular formula C23H28N2O5
and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol |
| PubChem CID | 162651802 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol |
| SMILES | COc1cc2nc(-c3ccco3)cc(OCCCN3CCC(O)CC3)c2cc1OC |
| InChI | InChI=1S/C23H28N2O5/c1-27-22-13-17-18(14-23(22)28-2)24-19(20-5-3-11-29-20)15-21(17)30-12-4-8-25-9-6-16(26)7-10-25/h3,5,11,13-16,26H,4,6-10,12H2,1-2H3 |
| InChIKey | YMYPMXXZKWMHEN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 77.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol?
The IUPAC name of 1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol (CID 162651802) is 1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol.
What is the SMILES notation for 1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol?
The canonical SMILES for 1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol is COc1cc2nc(-c3ccco3)cc(OCCCN3CCC(O)CC3)c2cc1OC.
What is the InChIKey of 1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol?
The InChIKey is YMYPMXXZKWMHEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O5/c1-27-22-13-17-18(14-23(22)28-2)24-19(20-5-3-11-29-20)15-21(17)30-12-4-8-25-9-6-16(26)7-10-25/h3,5,11,13-16,26H,4,6-10,12H2,1-2H3.
What are the key properties of 1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol?
1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol has a molecular weight of 412.49 g/mol, XLogP of 3.74, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[2-(furan-2-yl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]piperidin-4-ol is sourced from PubChem (CID 162651802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).