C37H15F11N4 — CID 162651867
5,15-bis(2,3,5,6-tetrafluorophenyl)-10-(2,3,5-trifluorophenyl)-22,23-dihydro-21H-corrin (PubChem CID 162651867) has the molecular formula C37H15F11N4 and a molecular weight of 724.53 g/mol. Its IUPAC name is 5,15-bis(2,3,5,6-tetrafluorophenyl)-10-(2,3,5-trifluorophenyl)-22,23-dihydro-21H-corrin.
| Compound Name | 5,15-bis(2,3,5,6-tetrafluorophenyl)-10-(2,3,5-trifluorophenyl)-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 162651867 |
| Molecular Formula | C37H15F11N4 |
| Molecular Weight | 724.53 g/mol |
| Exact Mass | 724.11 |
| IUPAC Name | 5,15-bis(2,3,5,6-tetrafluorophenyl)-10-(2,3,5-trifluorophenyl)-22,23-dihydro-21H-corrin |
| SMILES | Fc1cc(F)c(F)c(-c2c3ccc([nH]3)c(-c3c(F)c(F)cc(F)c3F)c3nc(c4ccc([nH]4)c(-c4c(F)c(F)cc(F)c4F)c4ccc2[nH]4)C=C3)c1 |
| InChI | InChI=1S/C37H15F11N4/c38-13-9-14(33(44)15(39)10-13)28-22-5-7-26(51-22)29(31-34(45)16(40)11-17(41)35(31)46)24-3-1-20(49-24)21-2-4-25(50-21)30(27-8-6-23(28)52-27)32-36(47)18(42)12-19(43)37(32)48/h1-12,49,51-52H/b21-20-,28-22-,28-23-,29-24+,29-26+,30-25+,30-27+ |
| InChIKey | FPJJGVGXHRQJEN-GCMUTNQRSA-N |
| XLogP | 11.23 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.53 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|