C18H15Cl2NO2 — CID 162652204
4-[(3,4-dichlorophenyl)methoxy]-6-methoxy-2-methylquinoline (PubChem CID 162652204) has the molecular formula C18H15Cl2NO2 and a molecular weight of 348.23 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methoxy]-6-methoxy-2-methylquinoline.
| Compound Name | 4-[(3,4-dichlorophenyl)methoxy]-6-methoxy-2-methylquinoline |
|---|---|
| PubChem CID | 162652204 |
| Molecular Formula | C18H15Cl2NO2 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methoxy]-6-methoxy-2-methylquinoline |
| SMILES | COc1ccc2nc(C)cc(OCc3ccc(Cl)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C18H15Cl2NO2/c1-11-7-18(14-9-13(22-2)4-6-17(14)21-11)23-10-12-3-5-15(19)16(20)8-12/h3-9H,10H2,1-2H3 |
| InChIKey | LNOPPGNOTHHPQA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |