C23H25BrCl2FN7O3 — CID 162652226
2-[3-[bis(2-chloroethyl)amino]phenyl]-N-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethyl]acetamide (PubChem CID 162652226) has the molecular formula C23H25BrCl2FN7O3 and a molecular weight of 617.31 g/mol. Its IUPAC name is 2-[3-[bis(2-chloroethyl)amino]phenyl]-N-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethyl]acetamide.
| Compound Name | 2-[3-[bis(2-chloroethyl)amino]phenyl]-N-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 162652226 |
| Molecular Formula | C23H25BrCl2FN7O3 |
| Molecular Weight | 617.31 g/mol |
| Exact Mass | 615.06 |
| IUPAC Name | 2-[3-[bis(2-chloroethyl)amino]phenyl]-N-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]ethyl]acetamide |
| SMILES | O=C(Cc1cccc(N(CCCl)CCCl)c1)NCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C23H25BrCl2FN7O3/c24-18-14-16(4-5-19(18)27)30-23(31-36)21-22(33-37-32-21)29-9-8-28-20(35)13-15-2-1-3-17(12-15)34(10-6-25)11-7-26/h1-5,12,14,36H,6-11,13H2,(H,28,35)(H,29,33)(H,30,31) |
| InChIKey | QGNKAWRJOHQHFT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|