C15H12N6O4 — CID 162652288
(2R)-2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]-2-phenylacetic acid (PubChem CID 162652288) has the molecular formula C15H12N6O4 and a molecular weight of 340.30 g/mol. Its IUPAC name is (2R)-2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 162652288 |
| Molecular Formula | C15H12N6O4 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (2R)-2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]-2-phenylacetic acid |
| SMILES | Nc1nc2nc(C(=O)N[C@@H](C(=O)O)c3ccccc3)cnc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H12N6O4/c16-15-20-11-10(13(23)21-15)17-6-8(18-11)12(22)19-9(14(24)25)7-4-2-1-3-5-7/h1-6,9H,(H,19,22)(H,24,25)(H3,16,18,20,21,23)/t9-/m1/s1 |
| InChIKey | CKTFFRDVMHUKQB-SECBINFHSA-N |
| XLogP | -0.15 |
| TPSA | 163.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |