C8H11N5O2 — CID 162652377
6-imino-1,3,9-trimethyl-7H-purine-2,8-dione (PubChem CID 162652377) has the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. Its IUPAC name is 6-imino-1,3,9-trimethyl-7H-purine-2,8-dione.
| Compound Name | 6-imino-1,3,9-trimethyl-7H-purine-2,8-dione |
|---|---|
| PubChem CID | 162652377 |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 6-imino-1,3,9-trimethyl-7H-purine-2,8-dione |
| SMILES | [H]/N=c1/c2[nH]c(=O)n(C)c2n(C)c(=O)n1C |
| InChI | InChI=1S/C8H11N5O2/c1-11-5(9)4-6(13(3)8(11)15)12(2)7(14)10-4/h9H,1-3H3,(H,10,14)/b9-5- |
| InChIKey | ZIXKNJXIKWYYLD-UITAMQMPSA-N |
| XLogP | -1.62 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |