C33H29IO7 — CID 162652501
(6S,6aR,7S,12aR)-4-iodo-1,8-dimethoxy-7-[(E)-2-(4-methoxyphenyl)ethenyl]-6-phenyl-6,6a,7,12a-tetrahydrochromeno[3,2-c]chromene-3,10-diol (PubChem CID 162652501) has the molecular formula C33H29IO7 and a molecular weight of 664.49 g/mol. Its IUPAC name is (6S,6aR,7S,12aR)-4-iodo-1,8-dimethoxy-7-[(E)-2-(4-methoxyphenyl)ethenyl]-6-phenyl-6,6a,7,12a-tetrahydrochromeno[3,2-c]chromene-3,10-diol.
| Compound Name | (6S,6aR,7S,12aR)-4-iodo-1,8-dimethoxy-7-[(E)-2-(4-methoxyphenyl)ethenyl]-6-phenyl-6,6a,7,12a-tetrahydrochromeno[3,2-c]chromene-3,10-diol |
|---|---|
| PubChem CID | 162652501 |
| Molecular Formula | C33H29IO7 |
| Molecular Weight | 664.49 g/mol |
| Exact Mass | 664.10 |
| IUPAC Name | (6S,6aR,7S,12aR)-4-iodo-1,8-dimethoxy-7-[(E)-2-(4-methoxyphenyl)ethenyl]-6-phenyl-6,6a,7,12a-tetrahydrochromeno[3,2-c]chromene-3,10-diol |
| SMILES | COc1ccc(/C=C/[C@@H]2c3c(OC)cc(O)cc3O[C@H]3c4c(OC)cc(O)c(I)c4O[C@H](c4ccccc4)[C@@H]23)cc1 |
| InChI | InChI=1S/C33H29IO7/c1-37-21-12-9-18(10-13-21)11-14-22-27-24(38-2)15-20(35)16-26(27)40-32-28(22)31(19-7-5-4-6-8-19)41-33-29(32)25(39-3)17-23(36)30(33)34/h4-17,22,28,31-32,35-36H,1-3H3/b14-11+/t22-,28-,31-,32-/m1/s1 |
| InChIKey | OYZCNCYPIGMLIH-LVGFTMSDSA-N |
| XLogP | 7.41 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.49 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|