About N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine
N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine (PubChem CID 162652644) has the molecular formula C18H26N4O2
and a molecular weight of 330.43 g/mol. Its IUPAC name is N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine.
Molecular Properties
| Compound Name | N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine |
| PubChem CID | 162652644 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine |
| SMILES | CCCCNc1nc(N2CCCC2)nc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C18H26N4O2/c1-4-5-8-19-17-13-11-15(23-2)16(24-3)12-14(13)20-18(21-17)22-9-6-7-10-22/h11-12H,4-10H2,1-3H3,(H,19,20,21) |
| InChIKey | QLLRSQRAYZFUJN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine?
The IUPAC name of N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine (CID 162652644) is N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine.
What is the SMILES notation for N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine?
The canonical SMILES for N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine is CCCCNc1nc(N2CCCC2)nc2cc(OC)c(OC)cc12.
What is the InChIKey of N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine?
The InChIKey is QLLRSQRAYZFUJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N4O2/c1-4-5-8-19-17-13-11-15(23-2)16(24-3)12-14(13)20-18(21-17)22-9-6-7-10-22/h11-12H,4-10H2,1-3H3,(H,19,20,21).
What are the key properties of N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine?
N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine has a molecular weight of 330.43 g/mol, XLogP of 3.46, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-6,7-dimethoxy-2-pyrrolidin-1-ylquinazolin-4-amine is sourced from PubChem (CID 162652644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).