C19H30O5 — CID 162652667
(3E,5R,6E,8S,9E,13S,14R)-5-hydroxy-8-methoxy-9-(methoxymethyl)-5,13,14-trimethyl-1-oxacyclotetradeca-3,6,9-trien-2-one (PubChem CID 162652667) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is (3E,5R,6E,8S,9E,13S,14R)-5-hydroxy-8-methoxy-9-(methoxymethyl)-5,13,14-trimethyl-1-oxacyclotetradeca-3,6,9-trien-2-one.
| Compound Name | (3E,5R,6E,8S,9E,13S,14R)-5-hydroxy-8-methoxy-9-(methoxymethyl)-5,13,14-trimethyl-1-oxacyclotetradeca-3,6,9-trien-2-one |
|---|---|
| PubChem CID | 162652667 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (3E,5R,6E,8S,9E,13S,14R)-5-hydroxy-8-methoxy-9-(methoxymethyl)-5,13,14-trimethyl-1-oxacyclotetradeca-3,6,9-trien-2-one |
| SMILES | COC/C1=C\CC[C@H](C)[C@@H](C)OC(=O)/C=C/[C@](C)(O)/C=C/[C@@H]1OC |
| InChI | InChI=1S/C19H30O5/c1-14-7-6-8-16(13-22-4)17(23-5)9-11-19(3,21)12-10-18(20)24-15(14)2/h8-12,14-15,17,21H,6-7,13H2,1-5H3/b11-9+,12-10+,16-8+/t14-,15+,17-,19+/m0/s1 |
| InChIKey | PXEWKROUBJGJOV-UPHWTYMLSA-N |
| XLogP | 2.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|