C29H35ClO7 — CID 162652800
[(1R,2R,4R,9S,10S,11S,13R,16R)-9-(acetyloxymethyl)-2,11-dihydroxy-5,5-dimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 4-chlorobenzoate (PubChem CID 162652800) has the molecular formula C29H35ClO7 and a molecular weight of 531.05 g/mol. Its IUPAC name is [(1R,2R,4R,9S,10S,11S,13R,16R)-9-(acetyloxymethyl)-2,11-dihydroxy-5,5-dimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 4-chlorobenzoate.
| Compound Name | [(1R,2R,4R,9S,10S,11S,13R,16R)-9-(acetyloxymethyl)-2,11-dihydroxy-5,5-dimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 162652800 |
| Molecular Formula | C29H35ClO7 |
| Molecular Weight | 531.05 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | [(1R,2R,4R,9S,10S,11S,13R,16R)-9-(acetyloxymethyl)-2,11-dihydroxy-5,5-dimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 4-chlorobenzoate |
| SMILES | C=C1C(=O)[C@@]23[C@H](O)C[C@@H]4C(C)(C)CCC[C@@]4(COC(C)=O)[C@@H]2[C@@H](O)C[C@H]1[C@H]3OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H35ClO7/c1-15-19-12-20(32)23-28(14-36-16(2)31)11-5-10-27(3,4)21(28)13-22(33)29(23,24(15)34)25(19)37-26(35)17-6-8-18(30)9-7-17/h6-9,19-23,25,32-33H,1,5,10-14H2,2-4H3/t19-,20+,21-,22-,23+,25-,28+,29-/m1/s1 |
| InChIKey | ZMRCVBDTQWBOIR-PGSPYRNJSA-N |
| XLogP | 4.13 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.05 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|