C14H13N5O4 — CID 162652864
ethyl 5-amino-2-(3,4-dihydroxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carboxylate (PubChem CID 162652864) has the molecular formula C14H13N5O4 and a molecular weight of 315.29 g/mol. Its IUPAC name is ethyl 5-amino-2-(3,4-dihydroxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carboxylate.
| Compound Name | ethyl 5-amino-2-(3,4-dihydroxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carboxylate |
|---|---|
| PubChem CID | 162652864 |
| Molecular Formula | C14H13N5O4 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | ethyl 5-amino-2-(3,4-dihydroxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carboxylate |
| SMILES | CCOC(=O)c1cnc(N)n2nc(-c3ccc(O)c(O)c3)nc12 |
| InChI | InChI=1S/C14H13N5O4/c1-2-23-13(22)8-6-16-14(15)19-12(8)17-11(18-19)7-3-4-9(20)10(21)5-7/h3-6,20-21H,2H2,1H3,(H2,15,16) |
| InChIKey | RLWCDORLWHHVNI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|