About N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide
N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide (PubChem CID 162652941) has the molecular formula C21H35NO
and a molecular weight of 317.52 g/mol. Its IUPAC name is N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide.
Molecular Properties
| Compound Name | N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide |
| PubChem CID | 162652941 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide |
| SMILES | CC(C)=CCC[C@H](C)CCNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H35NO/c1-15(2)5-4-6-16(3)7-8-22-20(23)21-12-17-9-18(13-21)11-19(10-17)14-21/h5,16-19H,4,6-14H2,1-3H3,(H,22,23)/t16-,17?,18?,19?,21?/m0/s1 |
| InChIKey | RTTRBEXIHAKIQE-PDRSHUBSSA-N |
| XLogP | 5.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide?
The IUPAC name of N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide (CID 162652941) is N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide.
What is the SMILES notation for N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide?
The canonical SMILES for N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide is CC(C)=CCC[C@H](C)CCNC(=O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide?
The InChIKey is RTTRBEXIHAKIQE-PDRSHUBSSA-N. The full InChI is InChI=1S/C21H35NO/c1-15(2)5-4-6-16(3)7-8-22-20(23)21-12-17-9-18(13-21)11-19(10-17)14-21/h5,16-19H,4,6-14H2,1-3H3,(H,22,23)/t16-,17?,18?,19?,21?/m0/s1.
What are the key properties of N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide?
N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide has a molecular weight of 317.52 g/mol, XLogP of 5.09, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-3,7-dimethyloct-6-enyl]adamantane-1-carboxamide is sourced from PubChem (CID 162652941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).