C46H53N11O4 — CID 162653017
7-[4-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperazin-1-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]heptanamide (PubChem CID 162653017) has the molecular formula C46H53N11O4 and a molecular weight of 824.00 g/mol. Its IUPAC name is 7-[4-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperazin-1-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]heptanamide.
| Compound Name | 7-[4-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperazin-1-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]heptanamide |
|---|---|
| PubChem CID | 162653017 |
| Molecular Formula | C46H53N11O4 |
| Molecular Weight | 824.00 g/mol |
| Exact Mass | 823.43 |
| IUPAC Name | 7-[4-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperazin-1-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]heptanamide |
| SMILES | O=C1CCC(N2Cc3c(NC(=O)CCCCCCN4CCN(c5ccc(Nc6ncc7nc(Nc8ccccc8)n(C8CCCC8)c7n6)cc5)CC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C46H53N11O4/c58-40(50-37-16-10-15-35-36(37)30-56(44(35)61)39-22-23-41(59)52-43(39)60)17-6-1-2-9-24-54-25-27-55(28-26-54)33-20-18-32(19-21-33)48-45-47-29-38-42(53-45)57(34-13-7-8-14-34)46(51-38)49-31-11-4-3-5-12-31/h3-5,10-12,15-16,18-21,29,34,39H,1-2,6-9,13-14,17,22-28,30H2,(H,49,51)(H,50,58)(H,47,48,53)(H,52,59,60) |
| InChIKey | WHKCGHLFWIJUOU-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.00 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|