About 2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol
2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol (PubChem CID 162653058) has the molecular formula C17H27N5O
and a molecular weight of 317.44 g/mol. Its IUPAC name is 2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol.
Molecular Properties
| Compound Name | 2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol |
| PubChem CID | 162653058 |
| Molecular Formula | C17H27N5O |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | 2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol |
| SMILES | CCCCC(CO)(CCCC)Nc1nc(N)nc2cccnc12 |
| InChI | InChI=1S/C17H27N5O/c1-3-5-9-17(12-23,10-6-4-2)22-15-14-13(8-7-11-19-14)20-16(18)21-15/h7-8,11,23H,3-6,9-10,12H2,1-2H3,(H3,18,20,21,22) |
| InChIKey | XRBYGKFEZVTEGX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol?
The IUPAC name of 2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol (CID 162653058) is 2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol.
What is the SMILES notation for 2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol?
The canonical SMILES for 2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol is CCCCC(CO)(CCCC)Nc1nc(N)nc2cccnc12.
What is the InChIKey of 2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol?
The InChIKey is XRBYGKFEZVTEGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N5O/c1-3-5-9-17(12-23,10-6-4-2)22-15-14-13(8-7-11-19-14)20-16(18)21-15/h7-8,11,23H,3-6,9-10,12H2,1-2H3,(H3,18,20,21,22).
What are the key properties of 2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol?
2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol has a molecular weight of 317.44 g/mol, XLogP of 3.13, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-butylhexan-1-ol is sourced from PubChem (CID 162653058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).