C16H9F3N2O3 — CID 162653144
methyl 3-[5-(2,4,5-trifluorophenyl)-1,3,4-oxadiazol-2-yl]benzoate (PubChem CID 162653144) has the molecular formula C16H9F3N2O3 and a molecular weight of 334.25 g/mol. Its IUPAC name is methyl 3-[5-(2,4,5-trifluorophenyl)-1,3,4-oxadiazol-2-yl]benzoate.
| Compound Name | methyl 3-[5-(2,4,5-trifluorophenyl)-1,3,4-oxadiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 162653144 |
| Molecular Formula | C16H9F3N2O3 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | methyl 3-[5-(2,4,5-trifluorophenyl)-1,3,4-oxadiazol-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2nnc(-c3cc(F)c(F)cc3F)o2)c1 |
| InChI | InChI=1S/C16H9F3N2O3/c1-23-16(22)9-4-2-3-8(5-9)14-20-21-15(24-14)10-6-12(18)13(19)7-11(10)17/h2-7H,1H3 |
| InChIKey | LLZPXHVWFKIFSO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|