C29H27N7O2S2 — CID 162653194
N-[4-[[4-[6-(3-aminophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]butyl]naphthalene-1-sulfonamide (PubChem CID 162653194) has the molecular formula C29H27N7O2S2 and a molecular weight of 569.72 g/mol. Its IUPAC name is N-[4-[[4-[6-(3-aminophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]butyl]naphthalene-1-sulfonamide.
| Compound Name | N-[4-[[4-[6-(3-aminophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]butyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 162653194 |
| Molecular Formula | C29H27N7O2S2 |
| Molecular Weight | 569.72 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | N-[4-[[4-[6-(3-aminophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]butyl]naphthalene-1-sulfonamide |
| SMILES | Nc1cccc(-c2nc3sccn3c2-c2ccnc(NCCCCNS(=O)(=O)c3cccc4ccccc34)n2)c1 |
| InChI | InChI=1S/C29H27N7O2S2/c30-22-10-5-9-21(19-22)26-27(36-17-18-39-29(36)35-26)24-13-16-32-28(34-24)31-14-3-4-15-33-40(37,38)25-12-6-8-20-7-1-2-11-23(20)25/h1-2,5-13,16-19,33H,3-4,14-15,30H2,(H,31,32,34) |
| InChIKey | RDNAHSWWUGPECY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 127.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.72 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|