About N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide
N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide (PubChem CID 162653316) has the molecular formula C25H22N4O4
and a molecular weight of 442.48 g/mol. Its IUPAC name is N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide.
Molecular Properties
| Compound Name | N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide |
| PubChem CID | 162653316 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1ccccc1C(=O)Nc1n[nH]c2cc(-c3cc(OC)cc(OC)c3)ccc12 |
| InChI | InChI=1S/C25H22N4O4/c1-4-23(30)26-21-8-6-5-7-20(21)25(31)27-24-19-10-9-15(13-22(19)28-29-24)16-11-17(32-2)14-18(12-16)33-3/h4-14H,1H2,2-3H3,(H,26,30)(H2,27,28,29,31) |
| InChIKey | XEZVRFAIDFHWBG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide?
The IUPAC name of N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide (CID 162653316) is N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide.
What is the SMILES notation for N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide?
The canonical SMILES for N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide is C=CC(=O)Nc1ccccc1C(=O)Nc1n[nH]c2cc(-c3cc(OC)cc(OC)c3)ccc12.
What is the InChIKey of N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide?
The InChIKey is XEZVRFAIDFHWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N4O4/c1-4-23(30)26-21-8-6-5-7-20(21)25(31)27-24-19-10-9-15(13-22(19)28-29-24)16-11-17(32-2)14-18(12-16)33-3/h4-14H,1H2,2-3H3,(H,26,30)(H2,27,28,29,31).
What are the key properties of N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide?
N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide has a molecular weight of 442.48 g/mol, XLogP of 4.62, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(3,5-dimethoxyphenyl)-1H-indazol-3-yl]-2-(prop-2-enoylamino)benzamide is sourced from PubChem (CID 162653316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).