About N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide
N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide (PubChem CID 162653542) has the molecular formula C26H27N3O2
and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide |
| PubChem CID | 162653542 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCc1ccc(C(=O)N2CCc3c(-c4ccccc4)cccc32)cc1 |
| InChI | InChI=1S/C26H27N3O2/c1-19(30)28-16-15-27-18-20-10-12-22(13-11-20)26(31)29-17-14-24-23(8-5-9-25(24)29)21-6-3-2-4-7-21/h2-13,27H,14-18H2,1H3,(H,28,30) |
| InChIKey | RZHVEGFKCLYFRL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide?
The IUPAC name of N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide (CID 162653542) is N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide.
What is the SMILES notation for N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide?
The canonical SMILES for N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide is CC(=O)NCCNCc1ccc(C(=O)N2CCc3c(-c4ccccc4)cccc32)cc1.
What is the InChIKey of N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide?
The InChIKey is RZHVEGFKCLYFRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27N3O2/c1-19(30)28-16-15-27-18-20-10-12-22(13-11-20)26(31)29-17-14-24-23(8-5-9-25(24)29)21-6-3-2-4-7-21/h2-13,27H,14-18H2,1H3,(H,28,30).
What are the key properties of N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide?
N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide has a molecular weight of 413.52 g/mol, XLogP of 3.78, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[4-(4-phenyl-2,3-dihydroindole-1-carbonyl)phenyl]methylamino]ethyl]acetamide is sourced from PubChem (CID 162653542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).