C33H36N6 — CID 162653636
4-[4-(1-decyltriazol-4-yl)phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 162653636) has the molecular formula C33H36N6 and a molecular weight of 516.69 g/mol. Its IUPAC name is 4-[4-(1-decyltriazol-4-yl)phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[4-(1-decyltriazol-4-yl)phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 162653636 |
| Molecular Formula | C33H36N6 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 4-[4-(1-decyltriazol-4-yl)phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | CCCCCCCCCCn1cc(-c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)nn1 |
| InChI | InChI=1S/C33H36N6/c1-2-3-4-5-6-7-8-13-22-39-25-33(37-38-39)27-18-16-26(17-19-27)28-23-31(29-14-9-11-20-34-29)36-32(24-28)30-15-10-12-21-35-30/h9-12,14-21,23-25H,2-8,13,22H2,1H3 |
| InChIKey | IPNHHWMEUBLGLU-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|