About 2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine
2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine (PubChem CID 162653690) has the molecular formula C22H21FN6
and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine.
Molecular Properties
| Compound Name | 2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine |
| PubChem CID | 162653690 |
| Molecular Formula | C22H21FN6 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine |
| SMILES | Nc1ncc(-c2cnn(C3CCNCC3)c2)c2ccc(-c3cccc(F)c3)nc12 |
| InChI | InChI=1S/C22H21FN6/c23-16-3-1-2-14(10-16)20-5-4-18-19(12-26-22(24)21(18)28-20)15-11-27-29(13-15)17-6-8-25-9-7-17/h1-5,10-13,17,25H,6-9H2,(H2,24,26) |
| InChIKey | SBMRKNIYXGMRRJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine?
The IUPAC name of 2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine (CID 162653690) is 2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine.
What is the SMILES notation for 2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine?
The canonical SMILES for 2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine is Nc1ncc(-c2cnn(C3CCNCC3)c2)c2ccc(-c3cccc(F)c3)nc12.
What is the InChIKey of 2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine?
The InChIKey is SBMRKNIYXGMRRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21FN6/c23-16-3-1-2-14(10-16)20-5-4-18-19(12-26-22(24)21(18)28-20)15-11-27-29(13-15)17-6-8-25-9-7-17/h1-5,10-13,17,25H,6-9H2,(H2,24,26).
What are the key properties of 2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine?
2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine has a molecular weight of 388.45 g/mol, XLogP of 3.81, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,7-naphthyridin-8-amine is sourced from PubChem (CID 162653690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).