C21H16F6N6O — CID 162653720
(11Z)-17-(trifluoromethyl)-5-[6-(trifluoromethyl)-2-pyridinyl]-14-oxa-2,4,6,8,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),11,15,17-heptaene (PubChem CID 162653720) has the molecular formula C21H16F6N6O and a molecular weight of 482.39 g/mol. Its IUPAC name is (11Z)-17-(trifluoromethyl)-5-[6-(trifluoromethyl)-2-pyridinyl]-14-oxa-2,4,6,8,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),11,15,17-heptaene.
| Compound Name | (11Z)-17-(trifluoromethyl)-5-[6-(trifluoromethyl)-2-pyridinyl]-14-oxa-2,4,6,8,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),11,15,17-heptaene |
|---|---|
| PubChem CID | 162653720 |
| Molecular Formula | C21H16F6N6O |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | (11Z)-17-(trifluoromethyl)-5-[6-(trifluoromethyl)-2-pyridinyl]-14-oxa-2,4,6,8,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),11,15,17-heptaene |
| SMILES | FC(F)(F)c1cc2cc(c1)OC/C=C/CCNc1nc(nc(-c3cccc(C(F)(F)F)n3)n1)N2 |
| InChI | InChI=1S/C21H16F6N6O/c22-20(23,24)12-9-13-11-14(10-12)34-8-3-1-2-7-28-18-31-17(32-19(29-13)33-18)15-5-4-6-16(30-15)21(25,26)27/h1,3-6,9-11H,2,7-8H2,(H2,28,29,31,32,33)/b3-1+ |
| InChIKey | IFMMQRPFAUETKS-HNQUOIGGSA-N |
| XLogP | 5.47 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|