C40H31BrN2O3 — CID 162653771
2-[3-[3,3-bis(1-benzofuran-2-yl)prop-2-enyl]-5,6-dimethylbenzimidazol-1-ium-1-yl]-1-naphthalen-2-ylethanone bromide (PubChem CID 162653771) has the molecular formula C40H31BrN2O3 and a molecular weight of 667.60 g/mol. Its IUPAC name is 2-[3-[3,3-bis(1-benzofuran-2-yl)prop-2-enyl]-5,6-dimethylbenzimidazol-1-ium-1-yl]-1-naphthalen-2-ylethanone bromide.
| Compound Name | 2-[3-[3,3-bis(1-benzofuran-2-yl)prop-2-enyl]-5,6-dimethylbenzimidazol-1-ium-1-yl]-1-naphthalen-2-ylethanone bromide |
|---|---|
| PubChem CID | 162653771 |
| Molecular Formula | C40H31BrN2O3 |
| Molecular Weight | 667.60 g/mol |
| Exact Mass | 666.15 |
| IUPAC Name | 2-[3-[3,3-bis(1-benzofuran-2-yl)prop-2-enyl]-5,6-dimethylbenzimidazol-1-ium-1-yl]-1-naphthalen-2-ylethanone bromide |
| SMILES | Cc1cc2c(cc1C)[n+](CC(=O)c1ccc3ccccc3c1)cn2CC=C(c1cc2ccccc2o1)c1cc2ccccc2o1.[Br-] |
| InChI | InChI=1S/C40H31N2O3.BrH/c1-26-19-34-35(20-27(26)2)42(24-36(43)30-16-15-28-9-3-4-10-29(28)21-30)25-41(34)18-17-33(39-22-31-11-5-7-13-37(31)44-39)40-23-32-12-6-8-14-38(32)45-40;/h3-17,19-23,25H,18,24H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | UXASEUMVSXCHJK-UHFFFAOYSA-M |
| XLogP | 6.21 |
| TPSA | 52.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|