C14H13F3N4O4 — CID 162653825
N-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline (PubChem CID 162653825) has the molecular formula C14H13F3N4O4 and a molecular weight of 358.28 g/mol. Its IUPAC name is N-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 162653825 |
| Molecular Formula | C14H13F3N4O4 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | N-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC(CNc1ccc(OC(F)(F)F)cc1)CC2 |
| InChI | InChI=1S/C14H13F3N4O4/c15-14(16,17)25-10-3-1-9(2-4-10)18-7-11-5-6-20-8-12(21(22)23)19-13(20)24-11/h1-4,8,11,18H,5-7H2 |
| InChIKey | ZEOPLYILSJLYMM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|